Ligand ID 17879
Biomolecule ID 5398
Path 1DL8/1/B/DA7`3015
PDB Chain ID B Quaternary
Name DA7
Isomeric SMILES Bound C[NH+](C)CCNC(=O)c1cccc2c1nc3c(c2N)cccc3F
Residue Number 3015
Heavy Atoms 24
Gini Index (Contacts) 0.22

Ligand Fragment ID Depiction Ligand ID Fragment ID Hit NPR1 NPR2 ASA Buriedness AASA Buriedness PASA Buriedness FCD FAD Root
Protein Fragment Chain Secondary Structure Length Sequence N-Terminal C-Terminal Completeness